C14H22N3O5P — CID 46894295
[1-[(4-amino-2-oxopyrimidin-1-yl)methyl]-3,4-dimethylcyclopent-3-en-1-yl]methoxymethylphosphonic acid (PubChem CID 46894295) has the molecular formula C14H22N3O5P and a molecular weight of 343.32 g/mol. Its IUPAC name is [1-[(4-amino-2-oxopyrimidin-1-yl)methyl]-3,4-dimethylcyclopent-3-en-1-yl]methoxymethylphosphonic acid.
| Compound Name | [1-[(4-amino-2-oxopyrimidin-1-yl)methyl]-3,4-dimethylcyclopent-3-en-1-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 46894295 |
| Molecular Formula | C14H22N3O5P |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | [1-[(4-amino-2-oxopyrimidin-1-yl)methyl]-3,4-dimethylcyclopent-3-en-1-yl]methoxymethylphosphonic acid |
| SMILES | CC1=C(C)CC(COCP(=O)(O)O)(Cn2ccc(N)nc2=O)C1 |
| InChI | InChI=1S/C14H22N3O5P/c1-10-5-14(6-11(10)2,8-22-9-23(19,20)21)7-17-4-3-12(15)16-13(17)18/h3-4H,5-9H2,1-2H3,(H2,15,16,18)(H2,19,20,21) |
| InChIKey | SORWPSZCNKZLGX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|