C10H16N3O4P — CID 59942649
[5-[(4-amino-2-oxopyrimidin-1-yl)methyl]oxolan-2-yl]-methylphosphinic acid (PubChem CID 59942649) has the molecular formula C10H16N3O4P and a molecular weight of 273.23 g/mol. Its IUPAC name is [5-[(4-amino-2-oxopyrimidin-1-yl)methyl]oxolan-2-yl]-methylphosphinic acid.
| Compound Name | [5-[(4-amino-2-oxopyrimidin-1-yl)methyl]oxolan-2-yl]-methylphosphinic acid |
|---|---|
| PubChem CID | 59942649 |
| Molecular Formula | C10H16N3O4P |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | [5-[(4-amino-2-oxopyrimidin-1-yl)methyl]oxolan-2-yl]-methylphosphinic acid |
| SMILES | CP(=O)(O)C1CCC(Cn2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C10H16N3O4P/c1-18(15,16)9-3-2-7(17-9)6-13-5-4-8(11)12-10(13)14/h4-5,7,9H,2-3,6H2,1H3,(H,15,16)(H2,11,12,14) |
| InChIKey | KLGQYCDRUYEXPE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|