C8H12N3O4P — CID 170568219
4-amino-1-[(2-hydroxy-1,4,2-dioxaphosphinan-5-yl)methyl]pyrimidin-2-one (PubChem CID 170568219) has the molecular formula C8H12N3O4P and a molecular weight of 245.17 g/mol. Its IUPAC name is 4-amino-1-[(2-hydroxy-1,4,2-dioxaphosphinan-5-yl)methyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2-hydroxy-1,4,2-dioxaphosphinan-5-yl)methyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 170568219 |
| Molecular Formula | C8H12N3O4P |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-amino-1-[(2-hydroxy-1,4,2-dioxaphosphinan-5-yl)methyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC2COP(O)CO2)c(=O)n1 |
| InChI | InChI=1S/C8H12N3O4P/c9-7-1-2-11(8(12)10-7)3-6-4-15-16(13)5-14-6/h1-2,6,13H,3-5H2,(H2,9,10,12) |
| InChIKey | YZUYUGOJFOACCV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|