C15H25N4O7P — CID 16659103
2-[[(5R)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2lambda5-dioxaphosphinan-2-yl]oxy]ethyl 2-amino-3-methylbutanoate (PubChem CID 16659103) has the molecular formula C15H25N4O7P and a molecular weight of 404.36 g/mol. Its IUPAC name is 2-[[(5R)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2lambda5-dioxaphosphinan-2-yl]oxy]ethyl 2-amino-3-methylbutanoate.
| Compound Name | 2-[[(5R)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2lambda5-dioxaphosphinan-2-yl]oxy]ethyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 16659103 |
| Molecular Formula | C15H25N4O7P |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[[(5R)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2lambda5-dioxaphosphinan-2-yl]oxy]ethyl 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OCCOP1(=O)CO[C@H](Cn2ccc(N)nc2=O)CO1 |
| InChI | InChI=1S/C15H25N4O7P/c1-10(2)13(17)14(20)23-5-6-25-27(22)9-24-11(8-26-27)7-19-4-3-12(16)18-15(19)21/h3-4,10-11,13H,5-9,17H2,1-2H3,(H2,16,18,21)/t11-,13?,27?/m1/s1 |
| InChIKey | WMHNZYAKGGDPBG-YGRFLLFGSA-N |
| XLogP | -0.07 |
| TPSA | 157.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|