C19H33N4O6P — CID 142433108
pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylpentanoate (PubChem CID 142433108) has the molecular formula C19H33N4O6P and a molecular weight of 444.47 g/mol. Its IUPAC name is pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylpentanoate.
| Compound Name | pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 142433108 |
| Molecular Formula | C19H33N4O6P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylpentanoate |
| SMILES | CCCCCOC(=O)[C@@H](NP1(=O)CO[C@@H](Cn2ccc(N)nc2=O)CO1)C(C)CC |
| InChI | InChI=1S/C19H33N4O6P/c1-4-6-7-10-27-18(24)17(14(3)5-2)22-30(26)13-28-15(12-29-30)11-23-9-8-16(20)21-19(23)25/h8-9,14-15,17H,4-7,10-13H2,1-3H3,(H,22,26)(H2,20,21,25)/t14?,15-,17-,30?/m0/s1 |
| InChIKey | MJICAKGOGPTNCD-MSTJZQIBSA-N |
| XLogP | 2.13 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|