C9H17N4O5P — CID 143480780
4-amino-1-[(2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-5-yl)methyl]-1,3,5-triazin-2-one;ethane (PubChem CID 143480780) has the molecular formula C9H17N4O5P and a molecular weight of 292.23 g/mol. Its IUPAC name is 4-amino-1-[(2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-5-yl)methyl]-1,3,5-triazin-2-one;ethane.
| Compound Name | 4-amino-1-[(2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-5-yl)methyl]-1,3,5-triazin-2-one;ethane |
|---|---|
| PubChem CID | 143480780 |
| Molecular Formula | C9H17N4O5P |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-amino-1-[(2-hydroxy-2-oxo-1,4,2λ5-dioxaphosphinan-5-yl)methyl]-1,3,5-triazin-2-one;ethane |
| SMILES | CC.Nc1ncn(CC2COP(=O)(O)CO2)c(=O)n1 |
| InChI | InChI=1S/C7H11N4O5P.C2H6/c8-6-9-3-11(7(12)10-6)1-5-2-16-17(13,14)4-15-5;1-2/h3,5H,1-2,4H2,(H,13,14)(H2,8,10,12);1-2H3 |
| InChIKey | OGHWCDVJCFAHNX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|