C8H13N5O2 — CID 57264933
4-amino-1-(morpholin-3-ylmethyl)-1,3,5-triazin-2-one (PubChem CID 57264933) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-amino-1-(morpholin-3-ylmethyl)-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-(morpholin-3-ylmethyl)-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 57264933 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-amino-1-(morpholin-3-ylmethyl)-1,3,5-triazin-2-one |
| SMILES | Nc1ncn(CC2COCCN2)c(=O)n1 |
| InChI | InChI=1S/C8H13N5O2/c9-7-11-5-13(8(14)12-7)3-6-4-15-2-1-10-6/h5-6,10H,1-4H2,(H2,9,12,14) |
| InChIKey | GFPMCJQFQPPWSA-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |