C13H12F2N2O3 — CID 103549626
5,6-difluoro-2-(morpholin-3-ylmethyl)isoindole-1,3-dione (PubChem CID 103549626) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 5,6-difluoro-2-(morpholin-3-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5,6-difluoro-2-(morpholin-3-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 103549626 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5,6-difluoro-2-(morpholin-3-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2cc(F)c(F)cc2C(=O)N1CC1COCCN1 |
| InChI | InChI=1S/C13H12F2N2O3/c14-10-3-8-9(4-11(10)15)13(19)17(12(8)18)5-7-6-20-2-1-16-7/h3-4,7,16H,1-2,5-6H2 |
| InChIKey | AANTXVKWTAMACM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|