C11H13F2NO2 — CID 82288355
3-[(3,4-difluorophenoxy)methyl]morpholine (PubChem CID 82288355) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-[(3,4-difluorophenoxy)methyl]morpholine.
| Compound Name | 3-[(3,4-difluorophenoxy)methyl]morpholine |
|---|---|
| PubChem CID | 82288355 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-[(3,4-difluorophenoxy)methyl]morpholine |
| SMILES | Fc1ccc(OCC2COCCN2)cc1F |
| InChI | InChI=1S/C11H13F2NO2/c12-10-2-1-9(5-11(10)13)16-7-8-6-15-4-3-14-8/h1-2,5,8,14H,3-4,6-7H2 |
| InChIKey | LKDSYASGYSCAGL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |