C9H13N3O3 — CID 83856794
6-(morpholin-3-ylmethyl)-1H-pyrimidine-2,4-dione (PubChem CID 83856794) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 6-(morpholin-3-ylmethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(morpholin-3-ylmethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83856794 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 6-(morpholin-3-ylmethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CC2COCCN2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N3O3/c13-8-4-6(11-9(14)12-8)3-7-5-15-2-1-10-7/h4,7,10H,1-3,5H2,(H2,11,12,13,14) |
| InChIKey | NHDVTBGYHZICRX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |