C13H15ClN4O — CID 118936318
(3R)-3-[[3-chloro-5-(triazol-2-yl)phenyl]methyl]morpholine (PubChem CID 118936318) has the molecular formula C13H15ClN4O and a molecular weight of 278.74 g/mol. Its IUPAC name is (3R)-3-[[3-chloro-5-(triazol-2-yl)phenyl]methyl]morpholine.
| Compound Name | (3R)-3-[[3-chloro-5-(triazol-2-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 118936318 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (3R)-3-[[3-chloro-5-(triazol-2-yl)phenyl]methyl]morpholine |
| SMILES | Clc1cc(C[C@@H]2COCCN2)cc(-n2nccn2)c1 |
| InChI | InChI=1S/C13H15ClN4O/c14-11-5-10(6-12-9-19-4-3-15-12)7-13(8-11)18-16-1-2-17-18/h1-2,5,7-8,12,15H,3-4,6,9H2/t12-/m1/s1 |
| InChIKey | JDIGPSZPEBQEHT-GFCCVEGCSA-N |
| XLogP | 1.45 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |