C8H13N5O3 — CID 103549359
6-(morpholin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 103549359) has the molecular formula C8H13N5O3 and a molecular weight of 227.22 g/mol. Its IUPAC name is 6-(morpholin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(morpholin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 103549359 |
| Molecular Formula | C8H13N5O3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 6-(morpholin-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCC2COCCN2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H13N5O3/c14-7-6(12-13-8(15)11-7)10-3-5-4-16-2-1-9-5/h5,9H,1-4H2,(H,10,12)(H2,11,13,14,15) |
| InChIKey | VIJOIOITZPPIGP-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |