C8H12N4O2S — CID 107296838
6-(thiolan-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 107296838) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 6-(thiolan-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(thiolan-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 107296838 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 6-(thiolan-3-ylmethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCC2CCSC2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N4O2S/c13-7-6(11-12-8(14)10-7)9-3-5-1-2-15-4-5/h5H,1-4H2,(H,9,11)(H2,10,12,13,14) |
| InChIKey | ZDXSBNPMVIMOLT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |