C10H12FN5S — CID 146282235
2-fluoro-N-(thiolan-3-ylmethyl)-7H-purin-6-amine (PubChem CID 146282235) has the molecular formula C10H12FN5S and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-fluoro-N-(thiolan-3-ylmethyl)-7H-purin-6-amine.
| Compound Name | 2-fluoro-N-(thiolan-3-ylmethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 146282235 |
| Molecular Formula | C10H12FN5S |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-fluoro-N-(thiolan-3-ylmethyl)-7H-purin-6-amine |
| SMILES | Fc1nc(NCC2CCSC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H12FN5S/c11-10-15-8(7-9(16-10)14-5-13-7)12-3-6-1-2-17-4-6/h5-6H,1-4H2,(H2,12,13,14,15,16) |
| InChIKey | GZHMBVMEQOGYFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |