C9H12FN3S — CID 107297717
6-fluoro-N-(thiolan-3-ylmethyl)pyrimidin-4-amine (PubChem CID 107297717) has the molecular formula C9H12FN3S and a molecular weight of 213.28 g/mol. Its IUPAC name is 6-fluoro-N-(thiolan-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-(thiolan-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107297717 |
| Molecular Formula | C9H12FN3S |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 6-fluoro-N-(thiolan-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Fc1cc(NCC2CCSC2)ncn1 |
| InChI | InChI=1S/C9H12FN3S/c10-8-3-9(13-6-12-8)11-4-7-1-2-14-5-7/h3,6-7H,1-2,4-5H2,(H,11,12,13) |
| InChIKey | WEIFLBOGRCSSBA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |