C10H15N3S — CID 107294970
2-N-(thiolan-3-ylmethyl)pyridine-2,4-diamine (PubChem CID 107294970) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 2-N-(thiolan-3-ylmethyl)pyridine-2,4-diamine.
| Compound Name | 2-N-(thiolan-3-ylmethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 107294970 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-N-(thiolan-3-ylmethyl)pyridine-2,4-diamine |
| SMILES | Nc1ccnc(NCC2CCSC2)c1 |
| InChI | InChI=1S/C10H15N3S/c11-9-1-3-12-10(5-9)13-6-8-2-4-14-7-8/h1,3,5,8H,2,4,6-7H2,(H3,11,12,13) |
| InChIKey | LACMPURLDHCSBZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |