C10H17N5S — CID 107298910
2-hydrazinyl-6-methyl-N-(thiolan-3-ylmethyl)pyrimidin-4-amine (PubChem CID 107298910) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 2-hydrazinyl-6-methyl-N-(thiolan-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-6-methyl-N-(thiolan-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107298910 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 2-hydrazinyl-6-methyl-N-(thiolan-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1cc(NCC2CCSC2)nc(NN)n1 |
| InChI | InChI=1S/C10H17N5S/c1-7-4-9(14-10(13-7)15-11)12-5-8-2-3-16-6-8/h4,8H,2-3,5-6,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | ULWHRQYKIREIQF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|