C15H19N3S — CID 107294982
2-methyl-4-N-(thiolan-3-ylmethyl)quinoline-4,6-diamine (PubChem CID 107294982) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-methyl-4-N-(thiolan-3-ylmethyl)quinoline-4,6-diamine.
| Compound Name | 2-methyl-4-N-(thiolan-3-ylmethyl)quinoline-4,6-diamine |
|---|---|
| PubChem CID | 107294982 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-methyl-4-N-(thiolan-3-ylmethyl)quinoline-4,6-diamine |
| SMILES | Cc1cc(NCC2CCSC2)c2cc(N)ccc2n1 |
| InChI | InChI=1S/C15H19N3S/c1-10-6-15(17-8-11-4-5-19-9-11)13-7-12(16)2-3-14(13)18-10/h2-3,6-7,11H,4-5,8-9,16H2,1H3,(H,17,18) |
| InChIKey | QEOXCBGRTOALRD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|