C11H17N3S — CID 107294876
4-methyl-2-N-(thiolan-3-ylmethyl)pyridine-2,5-diamine (PubChem CID 107294876) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-methyl-2-N-(thiolan-3-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 4-methyl-2-N-(thiolan-3-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 107294876 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-methyl-2-N-(thiolan-3-ylmethyl)pyridine-2,5-diamine |
| SMILES | Cc1cc(NCC2CCSC2)ncc1N |
| InChI | InChI=1S/C11H17N3S/c1-8-4-11(14-6-10(8)12)13-5-9-2-3-15-7-9/h4,6,9H,2-3,5,7,12H2,1H3,(H,13,14) |
| InChIKey | IKLQEYOKBJNFBE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |