C10H13BrN2S — CID 130692096
4-bromo-N-(thiolan-3-ylmethyl)pyridin-2-amine (PubChem CID 130692096) has the molecular formula C10H13BrN2S and a molecular weight of 273.20 g/mol. Its IUPAC name is 4-bromo-N-(thiolan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 4-bromo-N-(thiolan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130692096 |
| Molecular Formula | C10H13BrN2S |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-bromo-N-(thiolan-3-ylmethyl)pyridin-2-amine |
| SMILES | Brc1ccnc(NCC2CCSC2)c1 |
| InChI | InChI=1S/C10H13BrN2S/c11-9-1-3-12-10(5-9)13-6-8-2-4-14-7-8/h1,3,5,8H,2,4,6-7H2,(H,12,13) |
| InChIKey | ZXPBMDDYOQFEHQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |