C11H15BrN2S — CID 130956227
5-bromo-N-(thian-3-ylmethyl)pyridin-2-amine (PubChem CID 130956227) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-bromo-N-(thian-3-ylmethyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(thian-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130956227 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 5-bromo-N-(thian-3-ylmethyl)pyridin-2-amine |
| SMILES | Brc1ccc(NCC2CCCSC2)nc1 |
| InChI | InChI=1S/C11H15BrN2S/c12-10-3-4-11(14-7-10)13-6-9-2-1-5-15-8-9/h3-4,7,9H,1-2,5-6,8H2,(H,13,14) |
| InChIKey | VLEJSXWCRBYCOS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |