C13H22N4S — CID 107298863
6-N,2-diethyl-4-N-(thiolan-3-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 107298863) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 6-N,2-diethyl-4-N-(thiolan-3-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,2-diethyl-4-N-(thiolan-3-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107298863 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 6-N,2-diethyl-4-N-(thiolan-3-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCC2CCSC2)nc(CC)n1 |
| InChI | InChI=1S/C13H22N4S/c1-3-11-16-12(14-4-2)7-13(17-11)15-8-10-5-6-18-9-10/h7,10H,3-6,8-9H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | IXBCXGZUXABJFR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |