C13H19FN4 — CID 114156479
6-fluoro-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]pyrimidin-4-amine (PubChem CID 114156479) has the molecular formula C13H19FN4 and a molecular weight of 250.32 g/mol. Its IUPAC name is 6-fluoro-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114156479 |
| Molecular Formula | C13H19FN4 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 6-fluoro-N-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]pyrimidin-4-amine |
| SMILES | CN1C2CCC1CC(CNc1cc(F)ncn1)C2 |
| InChI | InChI=1S/C13H19FN4/c1-18-10-2-3-11(18)5-9(4-10)7-15-13-6-12(14)16-8-17-13/h6,8-11H,2-5,7H2,1H3,(H,15,16,17) |
| InChIKey | IJRXWRQUVANTML-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |