C7H13N5S — CID 107296847
1-methyl-N-(thiolan-3-ylmethyl)tetrazol-5-amine (PubChem CID 107296847) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-methyl-N-(thiolan-3-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(thiolan-3-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 107296847 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-methyl-N-(thiolan-3-ylmethyl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NCC1CCSC1 |
| InChI | InChI=1S/C7H13N5S/c1-12-7(9-10-11-12)8-4-6-2-3-13-5-6/h6H,2-5H2,1H3,(H,8,9,11) |
| InChIKey | QKBSDYIGHSRDHC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |