C9H16N4S — CID 107166795
N-[(1-methyltriazol-4-yl)methyl]-1-(thiolan-3-yl)methanamine (PubChem CID 107166795) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is N-[(1-methyltriazol-4-yl)methyl]-1-(thiolan-3-yl)methanamine.
| Compound Name | N-[(1-methyltriazol-4-yl)methyl]-1-(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 107166795 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-[(1-methyltriazol-4-yl)methyl]-1-(thiolan-3-yl)methanamine |
| SMILES | Cn1cc(CNCC2CCSC2)nn1 |
| InChI | InChI=1S/C9H16N4S/c1-13-6-9(11-12-13)5-10-4-8-2-3-14-7-8/h6,8,10H,2-5,7H2,1H3 |
| InChIKey | OPOQZICTWQQOTD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |