C8H16N6 — CID 63623261
1-methyl-N-(2-pyrrolidin-3-ylethyl)tetrazol-5-amine (PubChem CID 63623261) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is 1-methyl-N-(2-pyrrolidin-3-ylethyl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(2-pyrrolidin-3-ylethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 63623261 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-methyl-N-(2-pyrrolidin-3-ylethyl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NCCC1CCNC1 |
| InChI | InChI=1S/C8H16N6/c1-14-8(11-12-13-14)10-5-3-7-2-4-9-6-7/h7,9H,2-6H2,1H3,(H,10,11,13) |
| InChIKey | ADNPLQWRYMKRKL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |