C7H14N6 — CID 63320972
N-(1-methyltetrazol-5-yl)piperidin-3-amine (PubChem CID 63320972) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is N-(1-methyltetrazol-5-yl)piperidin-3-amine.
| Compound Name | N-(1-methyltetrazol-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 63320972 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | N-(1-methyltetrazol-5-yl)piperidin-3-amine |
| SMILES | Cn1nnnc1NC1CCCNC1 |
| InChI | InChI=1S/C7H14N6/c1-13-7(10-11-12-13)9-6-3-2-4-8-5-6/h6,8H,2-5H2,1H3,(H,9,10,12) |
| InChIKey | ATFOVQXEQLLBCP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |