C12H13F3N2O2S — CID 107298316
2-(thiolan-3-ylmethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 107298316) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-(thiolan-3-ylmethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(thiolan-3-ylmethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 107298316 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(thiolan-3-ylmethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1NCC1CCSC1 |
| InChI | InChI=1S/C12H13F3N2O2S/c13-12(14,15)9-2-1-8(11(18)19)10(17-9)16-5-7-3-4-20-6-7/h1-2,7H,3-6H2,(H,16,17)(H,18,19) |
| InChIKey | BVFWGERFMSBSAJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |