C12H15F3N2O3 — CID 107319679
2-(5-hydroxypentylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 107319679) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-(5-hydroxypentylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(5-hydroxypentylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 107319679 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(5-hydroxypentylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1NCCCCCO |
| InChI | InChI=1S/C12H15F3N2O3/c13-12(14,15)9-5-4-8(11(19)20)10(17-9)16-6-2-1-3-7-18/h4-5,18H,1-3,6-7H2,(H,16,17)(H,19,20) |
| InChIKey | JPGCIQSNOOFWQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|