C13H18F3N3O — CID 79869081
2-(hexylamino)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79869081) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(hexylamino)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(hexylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79869081 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(hexylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCCCCCNc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C13H18F3N3O/c1-2-3-4-5-8-18-12-9(11(17)20)6-7-10(19-12)13(14,15)16/h6-7H,2-5,8H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | NKMHSYFLACLKFS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|