C12H16F3N3O2 — CID 79876734
2-[(2-hydroxy-2-methylbutyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79876734) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-[(2-hydroxy-2-methylbutyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[(2-hydroxy-2-methylbutyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79876734 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[(2-hydroxy-2-methylbutyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCC(C)(O)CNc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C12H16F3N3O2/c1-3-11(2,20)6-17-10-7(9(16)19)4-5-8(18-10)12(13,14)15/h4-5,20H,3,6H2,1-2H3,(H2,16,19)(H,17,18) |
| InChIKey | VTINGJGVDAHBRT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |