C10H12F3N3O2 — CID 79869543
2-(2-methoxyethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79869543) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79869543 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-(2-methoxyethylamino)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COCCNc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C10H12F3N3O2/c1-18-5-4-15-9-6(8(14)17)2-3-7(16-9)10(11,12)13/h2-3H,4-5H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | XLLJJNQBFYNEME-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|