C7H10N3O5P — CID 23263317
4-amino-1-[(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl]pyrimidin-2-one (PubChem CID 23263317) has the molecular formula C7H10N3O5P and a molecular weight of 247.15 g/mol. Its IUPAC name is 4-amino-1-[(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 23263317 |
| Molecular Formula | C7H10N3O5P |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-amino-1-[(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl)methyl]pyrimidin-2-one |
| SMILES | Nc1ccn(CC2COP(=O)(O)O2)c(=O)n1 |
| InChI | InChI=1S/C7H10N3O5P/c8-6-1-2-10(7(11)9-6)3-5-4-14-16(12,13)15-5/h1-2,5H,3-4H2,(H,12,13)(H2,8,9,11) |
| InChIKey | MHZINEDMTUZWLE-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|