C9H11FN3O5PS — CID 130394189
1-[(4aR,7S,7aS)-7-fluoro-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one (PubChem CID 130394189) has the molecular formula C9H11FN3O5PS and a molecular weight of 323.24 g/mol. Its IUPAC name is 1-[(4aR,7S,7aS)-7-fluoro-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(4aR,7S,7aS)-7-fluoro-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 130394189 |
| Molecular Formula | C9H11FN3O5PS |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 1-[(4aR,7S,7aS)-7-fluoro-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-thieno[3,2-d][1,3,2]dioxaphosphinin-6-yl]-4-aminopyrimidin-2-one |
| SMILES | Nc1ccn(C2S[C@@H]3COP(=O)(O)O[C@H]3[C@@H]2F)c(=O)n1 |
| InChI | InChI=1S/C9H11FN3O5PS/c10-6-7-4(3-17-19(15,16)18-7)20-8(6)13-2-1-5(11)12-9(13)14/h1-2,4,6-8H,3H2,(H,15,16)(H2,11,12,14)/t4-,6+,7-,8?/m1/s1 |
| InChIKey | RFOVZLYSJQGTCG-RQFJETTJSA-N |
| XLogP | 0.29 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|