C9H12FN3OS — CID 145072910
4-amino-1-(3-fluoro-5-methylthiolan-2-yl)pyrimidin-2-one (PubChem CID 145072910) has the molecular formula C9H12FN3OS and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-amino-1-(3-fluoro-5-methylthiolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(3-fluoro-5-methylthiolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 145072910 |
| Molecular Formula | C9H12FN3OS |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-amino-1-(3-fluoro-5-methylthiolan-2-yl)pyrimidin-2-one |
| SMILES | CC1CC(F)C(n2ccc(N)nc2=O)S1 |
| InChI | InChI=1S/C9H12FN3OS/c1-5-4-6(10)8(15-5)13-3-2-7(11)12-9(13)14/h2-3,5-6,8H,4H2,1H3,(H2,11,12,14) |
| InChIKey | VZWNRFJXMCACJT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |