C7H8FN3O3 — CID 91595392
4-amino-1-(4-fluoro-1,3-dioxolan-2-yl)pyrimidin-2-one (PubChem CID 91595392) has the molecular formula C7H8FN3O3 and a molecular weight of 201.16 g/mol. Its IUPAC name is 4-amino-1-(4-fluoro-1,3-dioxolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(4-fluoro-1,3-dioxolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 91595392 |
| Molecular Formula | C7H8FN3O3 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-amino-1-(4-fluoro-1,3-dioxolan-2-yl)pyrimidin-2-one |
| SMILES | Nc1ccn(C2OCC(F)O2)c(=O)n1 |
| InChI | InChI=1S/C7H8FN3O3/c8-4-3-13-7(14-4)11-2-1-5(9)10-6(11)12/h1-2,4,7H,3H2,(H2,9,10,12) |
| InChIKey | FFASXPZGSCDKKU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |