C10H13N3O3 — CID 10751559
4-amino-1-[(3S,6S)-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]pyrimidin-2-one (PubChem CID 10751559) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-amino-1-[(3S,6S)-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3S,6S)-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10751559 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-amino-1-[(3S,6S)-6-(hydroxymethyl)-3,6-dihydro-2H-pyran-3-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@H]2C=C[C@@H](CO)OC2)c(=O)n1 |
| InChI | InChI=1S/C10H13N3O3/c11-9-3-4-13(10(15)12-9)7-1-2-8(5-14)16-6-7/h1-4,7-8,14H,5-6H2,(H2,11,12,15)/t7-,8-/m0/s1 |
| InChIKey | OPTKBOFHSIFGGS-YUMQZZPRSA-N |
| XLogP | -0.69 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|