C12H17N3O3 — CID 25053074
4-amino-1-[(1S,4S,5S)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one (PubChem CID 25053074) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-amino-1-[(1S,4S,5S)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1S,4S,5S)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 25053074 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-amino-1-[(1S,4S,5S)-4,5-bis(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2C=C[C@H](CO)[C@@H](CO)C2)c(=O)n1 |
| InChI | InChI=1S/C12H17N3O3/c13-11-3-4-15(12(18)14-11)10-2-1-8(6-16)9(5-10)7-17/h1-4,8-10,16-17H,5-7H2,(H2,13,14,18)/t8-,9-,10-/m1/s1 |
| InChIKey | NQDOODQARFFELT-OPRDCNLKSA-N |
| XLogP | -0.46 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|