C10H15N3O11P3- — CID 57365118
[[[(1S,4R)-4-(4-amino-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 57365118) has the molecular formula C10H15N3O11P3- and a molecular weight of 446.16 g/mol. Its IUPAC name is [[[(1S,4R)-4-(4-amino-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | [[[(1S,4R)-4-(4-amino-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 57365118 |
| Molecular Formula | C10H15N3O11P3- |
| Molecular Weight | 446.16 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | [[[(1S,4R)-4-(4-amino-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ccn([C@H]2C=C[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)([O-])O)C2)c(=O)n1 |
| InChI | InChI=1S/C10H16N3O11P3/c11-9-3-4-13(10(14)12-9)8-2-1-7(5-8)6-22-26(18,19)24-27(20,21)23-25(15,16)17/h1-4,7-8H,5-6H2,(H,18,19)(H,20,21)(H2,11,12,14)(H2,15,16,17)/p-1/t7-,8+/m1/s1 |
| InChIKey | ZXTSEKNVNNDUKY-SFYZADRCSA-M |
| XLogP | -0.35 |
| TPSA | 223.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|