C11H18N3O11P3 — CID 158607566
[[4-(4-amino-5-methyl-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 158607566) has the molecular formula C11H18N3O11P3 and a molecular weight of 461.20 g/mol. Its IUPAC name is [[4-(4-amino-5-methyl-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[4-(4-amino-5-methyl-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 158607566 |
| Molecular Formula | C11H18N3O11P3 |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | [[4-(4-amino-5-methyl-2-oxopyrimidin-1-yl)cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cn(C2C=CC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C2)c(=O)nc1N |
| InChI | InChI=1S/C11H18N3O11P3/c1-7-5-14(11(15)13-10(7)12)9-3-2-8(4-9)6-23-27(19,20)25-28(21,22)24-26(16,17)18/h2-3,5,8-9H,4,6H2,1H3,(H,19,20)(H,21,22)(H2,12,13,15)(H2,16,17,18) |
| InChIKey | KXLQFYKXACNXTA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 220.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|