C11H15N3O4 — CID 69460154
4-amino-1-[(1R,4R,5R,6S)-5,6-dihydroxy-4-(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one (PubChem CID 69460154) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-amino-1-[(1R,4R,5R,6S)-5,6-dihydroxy-4-(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(1R,4R,5R,6S)-5,6-dihydroxy-4-(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 69460154 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-amino-1-[(1R,4R,5R,6S)-5,6-dihydroxy-4-(hydroxymethyl)cyclohex-2-en-1-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2C=C[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C11H15N3O4/c12-8-3-4-14(11(18)13-8)7-2-1-6(5-15)9(16)10(7)17/h1-4,6-7,9-10,15-17H,5H2,(H2,12,13,18)/t6-,7-,9-,10+/m1/s1 |
| InChIKey | DZFWLDXFXXVGMS-ZXZZCXTASA-N |
| XLogP | -1.73 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|