C8H10BrN3O2 — CID 130156369
4-amino-1-(3-bromooxolan-2-yl)pyrimidin-2-one (PubChem CID 130156369) has the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. Its IUPAC name is 4-amino-1-(3-bromooxolan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(3-bromooxolan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 130156369 |
| Molecular Formula | C8H10BrN3O2 |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-amino-1-(3-bromooxolan-2-yl)pyrimidin-2-one |
| SMILES | Nc1ccn(C2OCCC2Br)c(=O)n1 |
| InChI | InChI=1S/C8H10BrN3O2/c9-5-2-4-14-7(5)12-3-1-6(10)11-8(12)13/h1,3,5,7H,2,4H2,(H2,10,11,13) |
| InChIKey | DGZNNDJORBVLGA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|