C18H33N4O6PS — CID 158276277
pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoate;sulfane (PubChem CID 158276277) has the molecular formula C18H33N4O6PS and a molecular weight of 464.53 g/mol. Its IUPAC name is pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoate;sulfane.
| Compound Name | pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoate;sulfane |
|---|---|
| PubChem CID | 158276277 |
| Molecular Formula | C18H33N4O6PS |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | pentyl (2S)-2-[[(5S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-2-oxo-1,4,2λ5-dioxaphosphinan-2-yl]amino]-3-methylbutanoate;sulfane |
| SMILES | CCCCCOC(=O)[C@@H](NP1(=O)CO[C@@H](Cn2ccc(N)nc2=O)CO1)C(C)C.S |
| InChI | InChI=1S/C18H31N4O6P.H2S/c1-4-5-6-9-26-17(23)16(13(2)3)21-29(25)12-27-14(11-28-29)10-22-8-7-15(19)20-18(22)24;/h7-8,13-14,16H,4-6,9-12H2,1-3H3,(H,21,25)(H2,19,20,24);1H2/t14-,16-,29?;/m0./s1 |
| InChIKey | GJQKSQONOXXQOP-LHYWJRDRSA-N |
| XLogP | 1.85 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|