C15H25N3O5 — CID 138654228
ethyl (3S)-4-(4-amino-2-oxopyrimidin-1-yl)-3-(butoxymethoxy)butanoate (PubChem CID 138654228) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl (3S)-4-(4-amino-2-oxopyrimidin-1-yl)-3-(butoxymethoxy)butanoate.
| Compound Name | ethyl (3S)-4-(4-amino-2-oxopyrimidin-1-yl)-3-(butoxymethoxy)butanoate |
|---|---|
| PubChem CID | 138654228 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | ethyl (3S)-4-(4-amino-2-oxopyrimidin-1-yl)-3-(butoxymethoxy)butanoate |
| SMILES | CCCCOCO[C@@H](CC(=O)OCC)Cn1ccc(N)nc1=O |
| InChI | InChI=1S/C15H25N3O5/c1-3-5-8-21-11-23-12(9-14(19)22-4-2)10-18-7-6-13(16)17-15(18)20/h6-7,12H,3-5,8-11H2,1-2H3,(H2,16,17,20)/t12-/m0/s1 |
| InChIKey | NQJIIINPSYGJEL-LBPRGKRZSA-N |
| XLogP | 0.94 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|