C13H20F2N3O6P — CID 162597630
[(2S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-4,4-difluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 162597630) has the molecular formula C13H20F2N3O6P and a molecular weight of 383.29 g/mol. Its IUPAC name is [(2S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-4,4-difluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [(2S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-4,4-difluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 162597630 |
| Molecular Formula | C13H20F2N3O6P |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [(2S)-5-[(4-amino-2-oxopyrimidin-1-yl)methyl]-4,4-difluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OC[C@@H]1CC(F)(F)C(Cn2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C13H20F2N3O6P/c1-8(2)24-25(20,21)22-7-9-5-13(14,15)10(23-9)6-18-4-3-11(16)17-12(18)19/h3-4,8-10H,5-7H2,1-2H3,(H,20,21)(H2,16,17,19)/t9-,10?/m0/s1 |
| InChIKey | SNBUVRMPHCVQTF-RGURZIINSA-N |
| XLogP | 1.16 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|