C14H25FN3O6P — CID 171568312
[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate;ethane (PubChem CID 171568312) has the molecular formula C14H25FN3O6P and a molecular weight of 381.34 g/mol. Its IUPAC name is [5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate;ethane.
| Compound Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate;ethane |
|---|---|
| PubChem CID | 171568312 |
| Molecular Formula | C14H25FN3O6P |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [5-(4-amino-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate;ethane |
| SMILES | CC.CC(C)OP(=O)(O)OCC1CC(F)C(n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C12H19FN3O6P.C2H6/c1-7(2)22-23(18,19)20-6-8-5-9(13)11(21-8)16-4-3-10(14)15-12(16)17;1-2/h3-4,7-9,11H,5-6H2,1-2H3,(H,18,19)(H2,14,15,17);1-2H3 |
| InChIKey | YXAKIOXVYOWWPP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|