C12H18F2N3O6P — CID 171568336
[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate (PubChem CID 171568336) has the molecular formula C12H18F2N3O6P and a molecular weight of 369.26 g/mol. Its IUPAC name is [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate.
| Compound Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 171568336 |
| Molecular Formula | C12H18F2N3O6P |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCC1CC(F)C(n2cc(F)c(N)nc2=O)O1 |
| InChI | InChI=1S/C12H18F2N3O6P/c1-6(2)23-24(19,20)21-5-7-3-8(13)11(22-7)17-4-9(14)10(15)16-12(17)18/h4,6-8,11H,3,5H2,1-2H3,(H,19,20)(H2,15,16,18) |
| InChIKey | PQPJGFWSLORXKR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|