C21H21F2N4O6P — CID 171568321
2-[[[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]acetaldehyde (PubChem CID 171568321) has the molecular formula C21H21F2N4O6P and a molecular weight of 494.39 g/mol. Its IUPAC name is 2-[[[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]acetaldehyde.
| Compound Name | 2-[[[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]acetaldehyde |
|---|---|
| PubChem CID | 171568321 |
| Molecular Formula | C21H21F2N4O6P |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2-[[[5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]acetaldehyde |
| SMILES | Nc1nc(=O)n(C2OC(COP(=O)(NCC=O)Oc3cccc4ccccc34)CC2F)cc1F |
| InChI | InChI=1S/C21H21F2N4O6P/c22-16-10-14(32-20(16)27-11-17(23)19(24)26-21(27)29)12-31-34(30,25-8-9-28)33-18-7-3-5-13-4-1-2-6-15(13)18/h1-7,9,11,14,16,20H,8,10,12H2,(H,25,30)(H2,24,26,29) |
| InChIKey | UXGLHOAXZJXBRM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|