C17H19ClFN4O6P — CID 171568394
2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetaldehyde (PubChem CID 171568394) has the molecular formula C17H19ClFN4O6P and a molecular weight of 460.79 g/mol. Its IUPAC name is 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetaldehyde.
| Compound Name | 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetaldehyde |
|---|---|
| PubChem CID | 171568394 |
| Molecular Formula | C17H19ClFN4O6P |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetaldehyde |
| SMILES | Nc1nc(=O)n(C2OC(COP(=O)(NCC=O)Oc3ccccc3)CC2F)cc1Cl |
| InChI | InChI=1S/C17H19ClFN4O6P/c18-13-9-23(17(25)22-15(13)20)16-14(19)8-12(28-16)10-27-30(26,21-6-7-24)29-11-4-2-1-3-5-11/h1-5,7,9,12,14,16H,6,8,10H2,(H,21,26)(H2,20,22,25) |
| InChIKey | SAFAMANEXVSOML-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 134.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|