C21H21ClFN4O5P — CID 144900339
2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde (PubChem CID 144900339) has the molecular formula C21H21ClFN4O5P and a molecular weight of 494.85 g/mol. Its IUPAC name is 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde.
| Compound Name | 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde |
|---|---|
| PubChem CID | 144900339 |
| Molecular Formula | C21H21ClFN4O5P |
| Molecular Weight | 494.85 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[[[5-(4-amino-5-chloro-2-oxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-naphthalen-2-yloxyphosphanyl]amino]acetaldehyde |
| SMILES | Nc1nc(=O)n(C2OC(COP(NCC=O)Oc3ccc4ccccc4c3)CC2F)cc1Cl |
| InChI | InChI=1S/C21H21ClFN4O5P/c22-17-11-27(21(29)26-19(17)24)20-18(23)10-16(31-20)12-30-33(25-7-8-28)32-15-6-5-13-3-1-2-4-14(13)9-15/h1-6,8-9,11,16,18,20,25H,7,10,12H2,(H2,24,26,29) |
| InChIKey | ZCFCSUCVIIEOCO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|